C20H28N2O3 — CID 31974696
N-[2-(4-tert-butylphenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide (PubChem CID 31974696) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide |
|---|---|
| PubChem CID | 31974696 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide |
| SMILES | Cc1noc(C)c1CCC(=O)NCCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-14-18(15(2)25-22-14)10-11-19(23)21-12-13-24-17-8-6-16(7-9-17)20(3,4)5/h6-9H,10-13H2,1-5H3,(H,21,23) |
| InChIKey | JGJFLPGMXKWXNM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|