C24H31FN4O5 — CID 166326068
1-[4-(3-fluorophenoxy)butanoyl]-3-[[1-[(1R,2R)-2-hydroxycyclopentyl]triazol-4-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 166326068) has the molecular formula C24H31FN4O5 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-[4-(3-fluorophenoxy)butanoyl]-3-[[1-[(1R,2R)-2-hydroxycyclopentyl]triazol-4-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[4-(3-fluorophenoxy)butanoyl]-3-[[1-[(1R,2R)-2-hydroxycyclopentyl]triazol-4-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166326068 |
| Molecular Formula | C24H31FN4O5 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1-[4-(3-fluorophenoxy)butanoyl]-3-[[1-[(1R,2R)-2-hydroxycyclopentyl]triazol-4-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(CCCOc1cccc(F)c1)N1CCCC(Cc2cn([C@@H]3CCC[C@H]3O)nn2)(C(=O)O)C1 |
| InChI | InChI=1S/C24H31FN4O5/c25-17-5-1-6-19(13-17)34-12-3-9-22(31)28-11-4-10-24(16-28,23(32)33)14-18-15-29(27-26-18)20-7-2-8-21(20)30/h1,5-6,13,15,20-21,30H,2-4,7-12,14,16H2,(H,32,33)/t20-,21-,24?/m1/s1 |
| InChIKey | KIYBRGSGFQPHLP-YHNKWQPZSA-N |
| XLogP | 2.60 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|