C14H18FNO3 — CID 93041279
3-(3-fluorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one (PubChem CID 93041279) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-(3-fluorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one.
| Compound Name | 3-(3-fluorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 93041279 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-(3-fluorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one |
| SMILES | O=C(CCOc1cccc(F)c1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C14H18FNO3/c15-11-3-1-5-13(9-11)19-8-6-14(18)16-7-2-4-12(17)10-16/h1,3,5,9,12,17H,2,4,6-8,10H2/t12-/m0/s1 |
| InChIKey | XNMNFWQQELOJKT-LBPRGKRZSA-N |
| XLogP | 1.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |