C14H16FNO5 — CID 61153262
(2S)-1-[3-(3-fluorophenoxy)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 61153262) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is (2S)-1-[3-(3-fluorophenoxy)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-(3-fluorophenoxy)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61153262 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2S)-1-[3-(3-fluorophenoxy)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)CN1C(=O)CCOc1cccc(F)c1 |
| InChI | InChI=1S/C14H16FNO5/c15-9-2-1-3-11(6-9)21-5-4-13(18)16-8-10(17)7-12(16)14(19)20/h1-3,6,10,12,17H,4-5,7-8H2,(H,19,20)/t10?,12-/m0/s1 |
| InChIKey | OTVVCPPPAYSUDD-KFJBMODSSA-N |
| XLogP | 0.64 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |