C14H17Cl2NO3 — CID 107224162
3-(3,4-dichlorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one (PubChem CID 107224162) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one.
| Compound Name | 3-(3,4-dichlorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 107224162 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)-1-[(3S)-3-hydroxypiperidin-1-yl]propan-1-one |
| SMILES | O=C(CCOc1ccc(Cl)c(Cl)c1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C14H17Cl2NO3/c15-12-4-3-11(8-13(12)16)20-7-5-14(19)17-6-1-2-10(18)9-17/h3-4,8,10,18H,1-2,5-7,9H2/t10-/m0/s1 |
| InChIKey | RWIVJUUYQYJICZ-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |