C14H15ClFNO3S — CID 119258201
1-[3-(2-chlorophenyl)sulfanylpropanoyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119258201) has the molecular formula C14H15ClFNO3S and a molecular weight of 331.80 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)sulfanylpropanoyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(2-chlorophenyl)sulfanylpropanoyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119258201 |
| Molecular Formula | C14H15ClFNO3S |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 1-[3-(2-chlorophenyl)sulfanylpropanoyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(CCSc1ccccc1Cl)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C14H15ClFNO3S/c15-10-3-1-2-4-11(10)21-8-5-12(18)17-7-6-14(16,9-17)13(19)20/h1-4H,5-9H2,(H,19,20) |
| InChIKey | VOQYJEOUMOPDEF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |