C13H12ClFN2O5S — CID 120529512
1-[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 120529512) has the molecular formula C13H12ClFN2O5S and a molecular weight of 362.77 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120529512 |
| Molecular Formula | C13H12ClFN2O5S |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(CSc1ccc(Cl)cc1[N+](=O)[O-])N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C13H12ClFN2O5S/c14-8-1-2-10(9(5-8)17(21)22)23-6-11(18)16-4-3-13(15,7-16)12(19)20/h1-2,5H,3-4,6-7H2,(H,19,20) |
| InChIKey | CKAZWGAQALOCCU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|