C13H15ClN2O5S — CID 120534752
4-[[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]amino]pentanoic acid (PubChem CID 120534752) has the molecular formula C13H15ClN2O5S and a molecular weight of 346.79 g/mol. Its IUPAC name is 4-[[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]amino]pentanoic acid.
| Compound Name | 4-[[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120534752 |
| Molecular Formula | C13H15ClN2O5S |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-[[2-(4-chloro-2-nitrophenyl)sulfanylacetyl]amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)CSc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15ClN2O5S/c1-8(2-5-13(18)19)15-12(17)7-22-11-4-3-9(14)6-10(11)16(20)21/h3-4,6,8H,2,5,7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | PDCZXFHJAKXMDU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|