C19H18FNO3S — CID 119258661
3-fluoro-1-(2-phenyl-2-phenylsulfanylacetyl)pyrrolidine-3-carboxylic acid (PubChem CID 119258661) has the molecular formula C19H18FNO3S and a molecular weight of 359.42 g/mol. Its IUPAC name is 3-fluoro-1-(2-phenyl-2-phenylsulfanylacetyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-(2-phenyl-2-phenylsulfanylacetyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119258661 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 3-fluoro-1-(2-phenyl-2-phenylsulfanylacetyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(C(Sc1ccccc1)c1ccccc1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C19H18FNO3S/c20-19(18(23)24)11-12-21(13-19)17(22)16(14-7-3-1-4-8-14)25-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,23,24) |
| InChIKey | QFNHIMCUSOTRKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |