C18H20N2OS — CID 119409196
1-[(3R)-3-aminopyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone (PubChem CID 119409196) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[(3R)-3-aminopyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone.
| Compound Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 119409196 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[(3R)-3-aminopyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone |
| SMILES | N[C@@H]1CCN(C(=O)C(Sc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C18H20N2OS/c19-15-11-12-20(13-15)18(21)17(14-7-3-1-4-8-14)22-16-9-5-2-6-10-16/h1-10,15,17H,11-13,19H2/t15-,17?/m1/s1 |
| InChIKey | NVYPLQBDLSOOFW-LDCVWXEPSA-N |
| XLogP | 3.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |