C19H23ClN2OS — CID 119483222
1-[3-(aminomethyl)pyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone;hydrochloride (PubChem CID 119483222) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 119483222 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[3-(aminomethyl)pyrrolidin-1-yl]-2-phenyl-2-phenylsulfanylethanone;hydrochloride |
| SMILES | Cl.NCC1CCN(C(=O)C(Sc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C19H22N2OS.ClH/c20-13-15-11-12-21(14-15)19(22)18(16-7-3-1-4-8-16)23-17-9-5-2-6-10-17;/h1-10,15,18H,11-14,20H2;1H |
| InChIKey | FPFBWEXBNFEHJK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |