C19H22N6O2S2 — CID 122348014
6-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-N-pyridin-4-ylpyridazin-3-amine (PubChem CID 122348014) has the molecular formula C19H22N6O2S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 6-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-N-pyridin-4-ylpyridazin-3-amine.
| Compound Name | 6-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-N-pyridin-4-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 122348014 |
| Molecular Formula | C19H22N6O2S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 6-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-N-pyridin-4-ylpyridazin-3-amine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3ccc(Nc4ccncc4)nn3)CC2)s1 |
| InChI | InChI=1S/C19H22N6O2S2/c1-2-16-3-6-19(28-16)29(26,27)25-13-11-24(12-14-25)18-5-4-17(22-23-18)21-15-7-9-20-10-8-15/h3-10H,2,11-14H2,1H3,(H,20,21,22) |
| InChIKey | SWRZVCKURHBLKO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |