C18H25N5O2S — CID 7178093
N-(4-methylphenyl)-6-(4-propylsulfonylpiperazin-1-yl)pyridazin-3-amine (PubChem CID 7178093) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is N-(4-methylphenyl)-6-(4-propylsulfonylpiperazin-1-yl)pyridazin-3-amine.
| Compound Name | N-(4-methylphenyl)-6-(4-propylsulfonylpiperazin-1-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 7178093 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-(4-methylphenyl)-6-(4-propylsulfonylpiperazin-1-yl)pyridazin-3-amine |
| SMILES | CCCS(=O)(=O)N1CCN(c2ccc(Nc3ccc(C)cc3)nn2)CC1 |
| InChI | InChI=1S/C18H25N5O2S/c1-3-14-26(24,25)23-12-10-22(11-13-23)18-9-8-17(20-21-18)19-16-6-4-15(2)5-7-16/h4-9H,3,10-14H2,1-2H3,(H,19,20) |
| InChIKey | BHZSSTOFAIFGKM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |