C14H21FN2O3S — CID 63310011
2-[4-[(4-fluorophenyl)methylsulfonyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 63310011) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methylsulfonyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[(4-fluorophenyl)methylsulfonyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 63310011 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methylsulfonyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C14H21FN2O3S/c15-14-4-2-13(3-5-14)12-21(19,20)17-7-1-6-16(8-9-17)10-11-18/h2-5,18H,1,6-12H2 |
| InChIKey | SMCRGYYXRFEBJW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |