C10H22N2O4S — CID 63310144
2-[4-(2-methoxyethylsulfonyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 63310144) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-[4-(2-methoxyethylsulfonyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(2-methoxyethylsulfonyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 63310144 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[4-(2-methoxyethylsulfonyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | COCCS(=O)(=O)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C10H22N2O4S/c1-16-9-10-17(14,15)12-4-2-3-11(5-6-12)7-8-13/h13H,2-10H2,1H3 |
| InChIKey | AAAJBYIINNOIDZ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |