C12H26N4O3S — CID 61254572
1-(2-methoxyethyl)-4-piperazin-1-ylsulfonyl-1,4-diazepane (PubChem CID 61254572) has the molecular formula C12H26N4O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-piperazin-1-ylsulfonyl-1,4-diazepane.
| Compound Name | 1-(2-methoxyethyl)-4-piperazin-1-ylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 61254572 |
| Molecular Formula | C12H26N4O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-(2-methoxyethyl)-4-piperazin-1-ylsulfonyl-1,4-diazepane |
| SMILES | COCCN1CCCN(S(=O)(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C12H26N4O3S/c1-19-12-11-14-5-2-6-15(10-9-14)20(17,18)16-7-3-13-4-8-16/h13H,2-12H2,1H3 |
| InChIKey | ZWWMBHLUKWQCBE-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |