C12H26N4O2S — CID 55217738
1-(3-ethyl-4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane (PubChem CID 55217738) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-(3-ethyl-4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(3-ethyl-4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 55217738 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(3-ethyl-4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane |
| SMILES | CCC1CN(S(=O)(=O)N2CCCNCC2)CCN1C |
| InChI | InChI=1S/C12H26N4O2S/c1-3-12-11-16(10-9-14(12)2)19(17,18)15-7-4-5-13-6-8-15/h12-13H,3-11H2,1-2H3 |
| InChIKey | VWHDQNZZUFTRBE-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |