C14H28N4O2S — CID 63170432
1-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonyl-1,4-diazepane (PubChem CID 63170432) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 63170432 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(N1CCCNCC1)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C14H28N4O2S/c19-21(20,17-10-4-6-15-7-12-17)18-11-5-14(13-18)16-8-2-1-3-9-16/h14-15H,1-13H2 |
| InChIKey | MUKPMSUMJFWCTD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |