C10H22N4O2S — CID 28746723
1-(4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane (PubChem CID 28746723) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 28746723 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)sulfonyl-1,4-diazepane |
| SMILES | CN1CCN(S(=O)(=O)N2CCCNCC2)CC1 |
| InChI | InChI=1S/C10H22N4O2S/c1-12-7-9-14(10-8-12)17(15,16)13-5-2-3-11-4-6-13/h11H,2-10H2,1H3 |
| InChIKey | CUPOHRYPJFPCIJ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |