C10H22N4O2S — CID 63608690
1,2-dimethyl-4-piperazin-1-ylsulfonylpiperazine (PubChem CID 63608690) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1,2-dimethyl-4-piperazin-1-ylsulfonylpiperazine.
| Compound Name | 1,2-dimethyl-4-piperazin-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 63608690 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1,2-dimethyl-4-piperazin-1-ylsulfonylpiperazine |
| SMILES | CC1CN(S(=O)(=O)N2CCNCC2)CCN1C |
| InChI | InChI=1S/C10H22N4O2S/c1-10-9-14(8-7-12(10)2)17(15,16)13-5-3-11-4-6-13/h10-11H,3-9H2,1-2H3 |
| InChIKey | VOEZSHCXWADFAM-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |