C10H22ClN3O3S — CID 119961532
2,6-dimethyl-4-piperazin-1-ylsulfonylmorpholine;hydrochloride (PubChem CID 119961532) has the molecular formula C10H22ClN3O3S and a molecular weight of 299.82 g/mol. Its IUPAC name is 2,6-dimethyl-4-piperazin-1-ylsulfonylmorpholine;hydrochloride.
| Compound Name | 2,6-dimethyl-4-piperazin-1-ylsulfonylmorpholine;hydrochloride |
|---|---|
| PubChem CID | 119961532 |
| Molecular Formula | C10H22ClN3O3S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2,6-dimethyl-4-piperazin-1-ylsulfonylmorpholine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)N2CCNCC2)CC(C)O1.Cl |
| InChI | InChI=1S/C10H21N3O3S.ClH/c1-9-7-13(8-10(2)16-9)17(14,15)12-5-3-11-4-6-12;/h9-11H,3-8H2,1-2H3;1H |
| InChIKey | QYRWGFVCFNUXQB-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |