C12H25N3O3S — CID 120725700
4-(2,3-dimethylpiperazin-1-yl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 120725700) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperazin-1-yl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-(2,3-dimethylpiperazin-1-yl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 120725700 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-(2,3-dimethylpiperazin-1-yl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)N2CCNC(C)C2C)CC(C)O1 |
| InChI | InChI=1S/C12H25N3O3S/c1-9-7-14(8-10(2)18-9)19(16,17)15-6-5-13-11(3)12(15)4/h9-13H,5-8H2,1-4H3 |
| InChIKey | ORLLFLSZCNMTIO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |