C11H23ClN2O3S — CID 120876580
2,3-dimethyl-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride (PubChem CID 120876580) has the molecular formula C11H23ClN2O3S and a molecular weight of 298.84 g/mol. Its IUPAC name is 2,3-dimethyl-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride.
| Compound Name | 2,3-dimethyl-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120876580 |
| Molecular Formula | C11H23ClN2O3S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2,3-dimethyl-1-(oxan-3-ylsulfonyl)piperazine;hydrochloride |
| SMILES | CC1NCCN(S(=O)(=O)C2CCCOC2)C1C.Cl |
| InChI | InChI=1S/C11H22N2O3S.ClH/c1-9-10(2)13(6-5-12-9)17(14,15)11-4-3-7-16-8-11;/h9-12H,3-8H2,1-2H3;1H |
| InChIKey | KZNHUADSQLSAST-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |