C12H25ClN2O3S — CID 120877009
3,3-dimethyl-1-(oxan-3-ylsulfonyl)piperidin-4-amine;hydrochloride (PubChem CID 120877009) has the molecular formula C12H25ClN2O3S and a molecular weight of 312.86 g/mol. Its IUPAC name is 3,3-dimethyl-1-(oxan-3-ylsulfonyl)piperidin-4-amine;hydrochloride.
| Compound Name | 3,3-dimethyl-1-(oxan-3-ylsulfonyl)piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120877009 |
| Molecular Formula | C12H25ClN2O3S |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3,3-dimethyl-1-(oxan-3-ylsulfonyl)piperidin-4-amine;hydrochloride |
| SMILES | CC1(C)CN(S(=O)(=O)C2CCCOC2)CCC1N.Cl |
| InChI | InChI=1S/C12H24N2O3S.ClH/c1-12(2)9-14(6-5-11(12)13)18(15,16)10-4-3-7-17-8-10;/h10-11H,3-9,13H2,1-2H3;1H |
| InChIKey | MJOQEYXZNNLHJM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |