About 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine
1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine (PubChem CID 165448574) has the molecular formula C11H22N2O2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine |
| PubChem CID | 165448574 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)CN(S(=O)(=O)C2CCCC2)CC1N |
| InChI | InChI=1S/C11H22N2O2S/c1-11(2)8-13(7-10(11)12)16(14,15)9-5-3-4-6-9/h9-10H,3-8,12H2,1-2H3 |
| InChIKey | FUSKPZBMQRHJTN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine?
The IUPAC name of 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine (CID 165448574) is 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine.
What is the SMILES notation for 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine?
The canonical SMILES for 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine is CC1(C)CN(S(=O)(=O)C2CCCC2)CC1N.
What is the InChIKey of 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine?
The InChIKey is FUSKPZBMQRHJTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2S/c1-11(2)8-13(7-10(11)12)16(14,15)9-5-3-4-6-9/h9-10H,3-8,12H2,1-2H3.
What are the key properties of 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine?
1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine has a molecular weight of 246.38 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylsulfonyl-4,4-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 165448574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).