C13H26N2O3S — CID 114782156
(4-cyclohexylsulfonyl-6,6-dimethylmorpholin-2-yl)methanamine (PubChem CID 114782156) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is (4-cyclohexylsulfonyl-6,6-dimethylmorpholin-2-yl)methanamine.
| Compound Name | (4-cyclohexylsulfonyl-6,6-dimethylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 114782156 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (4-cyclohexylsulfonyl-6,6-dimethylmorpholin-2-yl)methanamine |
| SMILES | CC1(C)CN(S(=O)(=O)C2CCCCC2)CC(CN)O1 |
| InChI | InChI=1S/C13H26N2O3S/c1-13(2)10-15(9-11(8-14)18-13)19(16,17)12-6-4-3-5-7-12/h11-12H,3-10,14H2,1-2H3 |
| InChIKey | GNAJJZLNPUODRR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |