C13H25BrN2O3S — CID 114781878
4-(azepan-1-ylsulfonyl)-6-(bromomethyl)-2,2-dimethylmorpholine (PubChem CID 114781878) has the molecular formula C13H25BrN2O3S and a molecular weight of 369.33 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-6-(bromomethyl)-2,2-dimethylmorpholine.
| Compound Name | 4-(azepan-1-ylsulfonyl)-6-(bromomethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114781878 |
| Molecular Formula | C13H25BrN2O3S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-6-(bromomethyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)N2CCCCCC2)CC(CBr)O1 |
| InChI | InChI=1S/C13H25BrN2O3S/c1-13(2)11-16(10-12(9-14)19-13)20(17,18)15-7-5-3-4-6-8-15/h12H,3-11H2,1-2H3 |
| InChIKey | CASSRUZXAINJNJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|