C12H23BrN2O3S — CID 114781805
6-(bromomethyl)-2,2-dimethyl-4-piperidin-1-ylsulfonylmorpholine (PubChem CID 114781805) has the molecular formula C12H23BrN2O3S and a molecular weight of 355.30 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-piperidin-1-ylsulfonylmorpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-piperidin-1-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 114781805 |
| Molecular Formula | C12H23BrN2O3S |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-piperidin-1-ylsulfonylmorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)N2CCCCC2)CC(CBr)O1 |
| InChI | InChI=1S/C12H23BrN2O3S/c1-12(2)10-15(9-11(8-13)18-12)19(16,17)14-6-4-3-5-7-14/h11H,3-10H2,1-2H3 |
| InChIKey | JZJZLBZHSGBRQK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|