C11H15Br2NO3S2 — CID 114781871
6-(bromomethyl)-4-(5-bromothiophen-2-yl)sulfonyl-2,2-dimethylmorpholine (PubChem CID 114781871) has the molecular formula C11H15Br2NO3S2 and a molecular weight of 433.19 g/mol. Its IUPAC name is 6-(bromomethyl)-4-(5-bromothiophen-2-yl)sulfonyl-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-(5-bromothiophen-2-yl)sulfonyl-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114781871 |
| Molecular Formula | C11H15Br2NO3S2 |
| Molecular Weight | 433.19 g/mol |
| Exact Mass | 430.89 |
| IUPAC Name | 6-(bromomethyl)-4-(5-bromothiophen-2-yl)sulfonyl-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)c2ccc(Br)s2)CC(CBr)O1 |
| InChI | InChI=1S/C11H15Br2NO3S2/c1-11(2)7-14(6-8(5-12)17-11)19(15,16)10-4-3-9(13)18-10/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | UWBHMFAZHSUHLE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|