C13H17BrFNO3S — CID 114781838
6-(bromomethyl)-4-(3-fluorophenyl)sulfonyl-2,2-dimethylmorpholine (PubChem CID 114781838) has the molecular formula C13H17BrFNO3S and a molecular weight of 366.25 g/mol. Its IUPAC name is 6-(bromomethyl)-4-(3-fluorophenyl)sulfonyl-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-(3-fluorophenyl)sulfonyl-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114781838 |
| Molecular Formula | C13H17BrFNO3S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 6-(bromomethyl)-4-(3-fluorophenyl)sulfonyl-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)c2cccc(F)c2)CC(CBr)O1 |
| InChI | InChI=1S/C13H17BrFNO3S/c1-13(2)9-16(8-11(7-14)19-13)20(17,18)12-5-3-4-10(15)6-12/h3-6,11H,7-9H2,1-2H3 |
| InChIKey | BFSHRBNNZCDZCK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|