C11H22BrNO3S — CID 114781810
6-(bromomethyl)-2,2-dimethyl-4-(2-methylpropylsulfonyl)morpholine (PubChem CID 114781810) has the molecular formula C11H22BrNO3S and a molecular weight of 328.27 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-(2-methylpropylsulfonyl)morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-(2-methylpropylsulfonyl)morpholine |
|---|---|
| PubChem CID | 114781810 |
| Molecular Formula | C11H22BrNO3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-(2-methylpropylsulfonyl)morpholine |
| SMILES | CC(C)CS(=O)(=O)N1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C11H22BrNO3S/c1-9(2)7-17(14,15)13-6-10(5-12)16-11(3,4)8-13/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZCEFBSXPJYRLHJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|