C12H24ClNO3S — CID 114781797
6-(chloromethyl)-2,2-dimethyl-4-(3-methylbutylsulfonyl)morpholine (PubChem CID 114781797) has the molecular formula C12H24ClNO3S and a molecular weight of 297.85 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-(3-methylbutylsulfonyl)morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-(3-methylbutylsulfonyl)morpholine |
|---|---|
| PubChem CID | 114781797 |
| Molecular Formula | C12H24ClNO3S |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-(3-methylbutylsulfonyl)morpholine |
| SMILES | CC(C)CCS(=O)(=O)N1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C12H24ClNO3S/c1-10(2)5-6-18(15,16)14-8-11(7-13)17-12(3,4)9-14/h10-11H,5-9H2,1-4H3 |
| InChIKey | LWMHNZQQVSYFKW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|