C11H22ClNO3S — CID 106731416
6-(chloromethyl)-4-(2-ethylsulfonylethyl)-2,2-dimethylmorpholine (PubChem CID 106731416) has the molecular formula C11H22ClNO3S and a molecular weight of 283.82 g/mol. Its IUPAC name is 6-(chloromethyl)-4-(2-ethylsulfonylethyl)-2,2-dimethylmorpholine.
| Compound Name | 6-(chloromethyl)-4-(2-ethylsulfonylethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 106731416 |
| Molecular Formula | C11H22ClNO3S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-(chloromethyl)-4-(2-ethylsulfonylethyl)-2,2-dimethylmorpholine |
| SMILES | CCS(=O)(=O)CCN1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C11H22ClNO3S/c1-4-17(14,15)6-5-13-8-10(7-12)16-11(2,3)9-13/h10H,4-9H2,1-3H3 |
| InChIKey | WRGOOZUZFSNZLT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|