C11H20ClNO3S — CID 114781770
6-(chloromethyl)-4-(cyclopropylmethylsulfonyl)-2,2-dimethylmorpholine (PubChem CID 114781770) has the molecular formula C11H20ClNO3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 6-(chloromethyl)-4-(cyclopropylmethylsulfonyl)-2,2-dimethylmorpholine.
| Compound Name | 6-(chloromethyl)-4-(cyclopropylmethylsulfonyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114781770 |
| Molecular Formula | C11H20ClNO3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 6-(chloromethyl)-4-(cyclopropylmethylsulfonyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(S(=O)(=O)CC2CC2)CC(CCl)O1 |
| InChI | InChI=1S/C11H20ClNO3S/c1-11(2)8-13(6-10(5-12)16-11)17(14,15)7-9-3-4-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | YSQOEBLCOAWIFS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|