C11H23NO4S — CID 114779112
(4-butylsulfonyl-6,6-dimethylmorpholin-2-yl)methanol (PubChem CID 114779112) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is (4-butylsulfonyl-6,6-dimethylmorpholin-2-yl)methanol.
| Compound Name | (4-butylsulfonyl-6,6-dimethylmorpholin-2-yl)methanol |
|---|---|
| PubChem CID | 114779112 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (4-butylsulfonyl-6,6-dimethylmorpholin-2-yl)methanol |
| SMILES | CCCCS(=O)(=O)N1CC(CO)OC(C)(C)C1 |
| InChI | InChI=1S/C11H23NO4S/c1-4-5-6-17(14,15)12-7-10(8-13)16-11(2,3)9-12/h10,13H,4-9H2,1-3H3 |
| InChIKey | XHCWDKVXHPIAIS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |