C12H25NO2 — CID 107886053
(6,6-dimethyl-4-pentan-2-ylmorpholin-2-yl)methanol (PubChem CID 107886053) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is (6,6-dimethyl-4-pentan-2-ylmorpholin-2-yl)methanol.
| Compound Name | (6,6-dimethyl-4-pentan-2-ylmorpholin-2-yl)methanol |
|---|---|
| PubChem CID | 107886053 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (6,6-dimethyl-4-pentan-2-ylmorpholin-2-yl)methanol |
| SMILES | CCCC(C)N1CC(CO)OC(C)(C)C1 |
| InChI | InChI=1S/C12H25NO2/c1-5-6-10(2)13-7-11(8-14)15-12(3,4)9-13/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | KYHLZMRTQGJALG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |