C12H24ClNO — CID 107887624
6-(chloromethyl)-2,2-dimethyl-4-pentan-2-ylmorpholine (PubChem CID 107887624) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-pentan-2-ylmorpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-pentan-2-ylmorpholine |
|---|---|
| PubChem CID | 107887624 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-pentan-2-ylmorpholine |
| SMILES | CCCC(C)N1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C12H24ClNO/c1-5-6-10(2)14-8-11(7-13)15-12(3,4)9-14/h10-11H,5-9H2,1-4H3 |
| InChIKey | LGZWYRSNWSBYBM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|