methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate

C11H21NO4 — CID 114777322

IUPACmethyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate
SMILESCOC(=O)C(C)N1CC(CO)OC(C)(C)C1
InChIInChI=1S/C11H21NO4/c1-8(10(14)15-4)12-5-9(6-13)16-11(2,3)7-12/h8-9,13H,5-7H2,1-4H3
InChIKeyFXWRDIDTJGABHV-UHFFFAOYSA-N
MW231.29 g/mol
LogP0.02
Rot. Bonds3

About methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate

methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate (PubChem CID 114777322) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate.

Molecular Properties

Compound Namemethyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate
PubChem CID114777322
Molecular FormulaC11H21NO4
Molecular Weight231.29 g/mol
Exact Mass231.15
IUPAC Namemethyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate
SMILESCOC(=O)C(C)N1CC(CO)OC(C)(C)C1
InChIInChI=1S/C11H21NO4/c1-8(10(14)15-4)12-5-9(6-13)16-11(2,3)7-12/h8-9,13H,5-7H2,1-4H3
InChIKeyFXWRDIDTJGABHV-UHFFFAOYSA-N
XLogP0.02
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.29
LogP ≤ 50.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate?
The IUPAC name of methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate (CID 114777322) is methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate.
What is the SMILES notation for methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate?
The canonical SMILES for methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate is COC(=O)C(C)N1CC(CO)OC(C)(C)C1.
What is the InChIKey of methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate?
The InChIKey is FXWRDIDTJGABHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-8(10(14)15-4)12-5-9(6-13)16-11(2,3)7-12/h8-9,13H,5-7H2,1-4H3.
What are the key properties of methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate?
methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate has a molecular weight of 231.29 g/mol, XLogP of 0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]propanoate is sourced from PubChem (CID 114777322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).