C9H18N2O3 — CID 114779554
2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]acetamide (PubChem CID 114779554) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]acetamide.
| Compound Name | 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 114779554 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]acetamide |
| SMILES | CC1(C)CN(CC(N)=O)CC(CO)O1 |
| InChI | InChI=1S/C9H18N2O3/c1-9(2)6-11(4-8(10)13)3-7(5-12)14-9/h7,12H,3-6H2,1-2H3,(H2,10,13) |
| InChIKey | MGAGOTLSUVJJJT-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |