C9H20N2O2 — CID 114776413
[4-(2-aminoethyl)-6,6-dimethylmorpholin-2-yl]methanol (PubChem CID 114776413) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is [4-(2-aminoethyl)-6,6-dimethylmorpholin-2-yl]methanol.
| Compound Name | [4-(2-aminoethyl)-6,6-dimethylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114776413 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | [4-(2-aminoethyl)-6,6-dimethylmorpholin-2-yl]methanol |
| SMILES | CC1(C)CN(CCN)CC(CO)O1 |
| InChI | InChI=1S/C9H20N2O2/c1-9(2)7-11(4-3-10)5-8(6-12)13-9/h8,12H,3-7,10H2,1-2H3 |
| InChIKey | DPRMFUNYTFCAOJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |