About 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide
2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide (PubChem CID 114782484) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide.
Molecular Properties
| Compound Name | 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide |
| PubChem CID | 114782484 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N1CC(CN)OC(C)(C)C1 |
| InChI | InChI=1S/C13H27N3O2/c1-5-6-15-12(17)10(2)16-8-11(7-14)18-13(3,4)9-16/h10-11H,5-9,14H2,1-4H3,(H,15,17) |
| InChIKey | CZAXLXWUJNTAGM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide?
The IUPAC name of 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide (CID 114782484) is 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide.
What is the SMILES notation for 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide?
The canonical SMILES for 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide is CCCNC(=O)C(C)N1CC(CN)OC(C)(C)C1.
What is the InChIKey of 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide?
The InChIKey is CZAXLXWUJNTAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-5-6-15-12(17)10(2)16-8-11(7-14)18-13(3,4)9-16/h10-11H,5-9,14H2,1-4H3,(H,15,17).
What are the key properties of 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide?
2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide has a molecular weight of 257.38 g/mol, XLogP of 0.34, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]-N-propylpropanamide is sourced from PubChem (CID 114782484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).