C17H34N2O2 — CID 114782057
1-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]decan-1-one (PubChem CID 114782057) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 1-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]decan-1-one.
| Compound Name | 1-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]decan-1-one |
|---|---|
| PubChem CID | 114782057 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 1-[6-(aminomethyl)-2,2-dimethylmorpholin-4-yl]decan-1-one |
| SMILES | CCCCCCCCCC(=O)N1CC(CN)OC(C)(C)C1 |
| InChI | InChI=1S/C17H34N2O2/c1-4-5-6-7-8-9-10-11-16(20)19-13-15(12-18)21-17(2,3)14-19/h15H,4-14,18H2,1-3H3 |
| InChIKey | OFHCUTDCHGIOGL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|