C16H30BrNO2 — CID 114781544
1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]nonan-1-one (PubChem CID 114781544) has the molecular formula C16H30BrNO2 and a molecular weight of 348.33 g/mol. Its IUPAC name is 1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]nonan-1-one.
| Compound Name | 1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]nonan-1-one |
|---|---|
| PubChem CID | 114781544 |
| Molecular Formula | C16H30BrNO2 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C16H30BrNO2/c1-4-5-6-7-8-9-10-15(19)18-12-14(11-17)20-16(2,3)13-18/h14H,4-13H2,1-3H3 |
| InChIKey | YDJDLFKHRYNMQU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|