C15H26BrNO3 — CID 114781501
1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-3-(oxan-2-yl)propan-1-one (PubChem CID 114781501) has the molecular formula C15H26BrNO3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-3-(oxan-2-yl)propan-1-one.
| Compound Name | 1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-3-(oxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 114781501 |
| Molecular Formula | C15H26BrNO3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 1-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-3-(oxan-2-yl)propan-1-one |
| SMILES | CC1(C)CN(C(=O)CCC2CCCCO2)CC(CBr)O1 |
| InChI | InChI=1S/C15H26BrNO3/c1-15(2)11-17(10-13(9-16)20-15)14(18)7-6-12-5-3-4-8-19-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | FIMRTEBURPCSHS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|