C16H28BrNO2 — CID 107184453
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,2-dimethylcyclohexyl)methanone (PubChem CID 107184453) has the molecular formula C16H28BrNO2 and a molecular weight of 346.31 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,2-dimethylcyclohexyl)methanone.
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,2-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 107184453 |
| Molecular Formula | C16H28BrNO2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,2-dimethylcyclohexyl)methanone |
| SMILES | CC1(C)CN(C(=O)C2CCCCC2(C)C)CC(CBr)O1 |
| InChI | InChI=1S/C16H28BrNO2/c1-15(2)8-6-5-7-13(15)14(19)18-10-12(9-17)20-16(3,4)11-18/h12-13H,5-11H2,1-4H3 |
| InChIKey | GPBFCXCYMISYSD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|