C16H22BrNO2 — CID 114781527
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3,4-dimethylphenyl)methanone (PubChem CID 114781527) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3,4-dimethylphenyl)methanone.
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 114781527 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CC(CBr)OC(C)(C)C2)cc1C |
| InChI | InChI=1S/C16H22BrNO2/c1-11-5-6-13(7-12(11)2)15(19)18-9-14(8-17)20-16(3,4)10-18/h5-7,14H,8-10H2,1-4H3 |
| InChIKey | VFDKZYKREYAZSV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|