C14H15BrF3NO2 — CID 114781494
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,4,6-trifluorophenyl)methanone (PubChem CID 114781494) has the molecular formula C14H15BrF3NO2 and a molecular weight of 366.18 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,4,6-trifluorophenyl)methanone.
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 114781494 |
| Molecular Formula | C14H15BrF3NO2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2,4,6-trifluorophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2c(F)cc(F)cc2F)CC(CBr)O1 |
| InChI | InChI=1S/C14H15BrF3NO2/c1-14(2)7-19(6-9(5-15)21-14)13(20)12-10(17)3-8(16)4-11(12)18/h3-4,9H,5-7H2,1-2H3 |
| InChIKey | VSQADIUVVZJWLZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|