C12H15Br2NO3 — CID 114781615
(5-bromofuran-2-yl)-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]methanone (PubChem CID 114781615) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 114781615 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | (5-bromofuran-2-yl)-[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc(Br)o2)CC(CBr)O1 |
| InChI | InChI=1S/C12H15Br2NO3/c1-12(2)7-15(6-8(5-13)18-12)11(16)9-3-4-10(14)17-9/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | QFBGIYBNMKQATC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|