About [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone (PubChem CID 114781702) has the molecular formula C14H20BrNO2S
and a molecular weight of 346.29 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone.
Molecular Properties
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone |
| PubChem CID | 114781702 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone |
| SMILES | CCc1ccc(C(=O)N2CC(CBr)OC(C)(C)C2)s1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-4-11-5-6-12(19-11)13(17)16-8-10(7-15)18-14(2,3)9-16/h5-6,10H,4,7-9H2,1-3H3 |
| InChIKey | YDFNRCXLDRAFSI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone?
The IUPAC name of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone (CID 114781702) is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone.
What is the SMILES notation for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone?
The canonical SMILES for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone is CCc1ccc(C(=O)N2CC(CBr)OC(C)(C)C2)s1.
What is the InChIKey of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone?
The InChIKey is YDFNRCXLDRAFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO2S/c1-4-11-5-6-12(19-11)13(17)16-8-10(7-15)18-14(2,3)9-16/h5-6,10H,4,7-9H2,1-3H3.
What are the key properties of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone?
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone has a molecular weight of 346.29 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-ethylthiophen-2-yl)methanone is sourced from PubChem (CID 114781702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).