About [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone (PubChem CID 114781714) has the molecular formula C15H19BrClNO2
and a molecular weight of 360.68 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone.
Molecular Properties
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone |
| PubChem CID | 114781714 |
| Molecular Formula | C15H19BrClNO2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CC(CBr)OC(C)(C)C2)c1Cl |
| InChI | InChI=1S/C15H19BrClNO2/c1-10-5-4-6-12(13(10)17)14(19)18-8-11(7-16)20-15(2,3)9-18/h4-6,11H,7-9H2,1-3H3 |
| InChIKey | YEPOCKKVNZMFBN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone?
The IUPAC name of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone (CID 114781714) is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone.
What is the SMILES notation for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone?
The canonical SMILES for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone is Cc1cccc(C(=O)N2CC(CBr)OC(C)(C)C2)c1Cl.
What is the InChIKey of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone?
The InChIKey is YEPOCKKVNZMFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrClNO2/c1-10-5-4-6-12(13(10)17)14(19)18-8-11(7-16)20-15(2,3)9-18/h4-6,11H,7-9H2,1-3H3.
What are the key properties of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone?
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone has a molecular weight of 360.68 g/mol, XLogP of 3.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(2-chloro-3-methylphenyl)methanone is sourced from PubChem (CID 114781714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).